C28H38N4O9 — CID 118082754
3-[(2R)-5-(dimethylamino)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-7-(morpholine-4-carbonyl)-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide (PubChem CID 118082754) has the molecular formula C28H38N4O9 and a molecular weight of 574.63 g/mol. Its IUPAC name is 3-[(2R)-5-(dimethylamino)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-7-(morpholine-4-carbonyl)-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide.
| Compound Name | 3-[(2R)-5-(dimethylamino)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-7-(morpholine-4-carbonyl)-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 118082754 |
| Molecular Formula | C28H38N4O9 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 3-[(2R)-5-(dimethylamino)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-7-(morpholine-4-carbonyl)-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide |
| SMILES | CN(C)c1cc(C(=O)N2CCOCC2)c(O)c2c1CC1CC([C@@H](CO)N(C)C)[C@@](O)(C(=O)CC(N)=O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H38N4O9/c1-30(2)18-11-16(27(39)32-5-7-41-8-6-32)24(36)23-15(18)9-14-10-17(19(13-33)31(3)4)28(40,20(34)12-21(29)35)26(38)22(14)25(23)37/h11,14,17,19,33,36-37,40H,5-10,12-13H2,1-4H3,(H2,29,35)/t14?,17?,19-,28-/m1/s1 |
| InChIKey | FKRWPZQDGYBKDU-WAZFUQROSA-N |
| XLogP | -0.94 |
| TPSA | 194.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|