C28H41N3O7 — CID 88940541
3-[(2R,3S,4aR)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-[(2,2-dimethylpropylamino)methyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-2-methyl-3-oxopropanamide (PubChem CID 88940541) has the molecular formula C28H41N3O7 and a molecular weight of 531.65 g/mol. Its IUPAC name is 3-[(2R,3S,4aR)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-[(2,2-dimethylpropylamino)methyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-2-methyl-3-oxopropanamide.
| Compound Name | 3-[(2R,3S,4aR)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-[(2,2-dimethylpropylamino)methyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-2-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 88940541 |
| Molecular Formula | C28H41N3O7 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 3-[(2R,3S,4aR)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-[(2,2-dimethylpropylamino)methyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-2-methyl-3-oxopropanamide |
| SMILES | CC(C(N)=O)C(=O)[C@@]1(O)C(=O)C2=C(O)c3c(ccc(CNCC(C)(C)C)c3O)C[C@H]2C[C@H]1C(CO)N(C)C |
| InChI | InChI=1S/C28H41N3O7/c1-14(26(29)37)24(35)28(38)18(19(12-32)31(5)6)10-17-9-15-7-8-16(11-30-13-27(2,3)4)22(33)20(15)23(34)21(17)25(28)36/h7-8,14,17-19,30,32-34,38H,9-13H2,1-6H3,(H2,29,37)/t14?,17-,18-,19?,28+/m0/s1 |
| InChIKey | LCQRIPKKYJERIW-JNZKNBPDSA-N |
| XLogP | 0.90 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|