C25H33N3O9 — CID 118082755
methyl (6S,7R,10aR)-7-(3-amino-3-oxopropanoyl)-4-(dimethylamino)-6-[1-(dimethylamino)-2-hydroxyethyl]-1,7,9-trihydroxy-8-oxo-5,6,10,10a-tetrahydroanthracene-2-carboxylate (PubChem CID 118082755) has the molecular formula C25H33N3O9 and a molecular weight of 519.55 g/mol. Its IUPAC name is methyl (6S,7R,10aR)-7-(3-amino-3-oxopropanoyl)-4-(dimethylamino)-6-[1-(dimethylamino)-2-hydroxyethyl]-1,7,9-trihydroxy-8-oxo-5,6,10,10a-tetrahydroanthracene-2-carboxylate.
| Compound Name | methyl (6S,7R,10aR)-7-(3-amino-3-oxopropanoyl)-4-(dimethylamino)-6-[1-(dimethylamino)-2-hydroxyethyl]-1,7,9-trihydroxy-8-oxo-5,6,10,10a-tetrahydroanthracene-2-carboxylate |
|---|---|
| PubChem CID | 118082755 |
| Molecular Formula | C25H33N3O9 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | methyl (6S,7R,10aR)-7-(3-amino-3-oxopropanoyl)-4-(dimethylamino)-6-[1-(dimethylamino)-2-hydroxyethyl]-1,7,9-trihydroxy-8-oxo-5,6,10,10a-tetrahydroanthracene-2-carboxylate |
| SMILES | COC(=O)c1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@](O)(C(=O)CC(N)=O)[C@H](C(CO)N(C)C)C[C@@H]1C2 |
| InChI | InChI=1S/C25H33N3O9/c1-27(2)15-8-13(24(35)37-5)21(32)20-12(15)6-11-7-14(16(10-29)28(3)4)25(36,17(30)9-18(26)31)23(34)19(11)22(20)33/h8,11,14,16,29,32-33,36H,6-7,9-10H2,1-5H3,(H2,26,31)/t11-,14-,16?,25+/m0/s1 |
| InChIKey | CVMODCMKGVFWQE-NOGJDWACSA-N |
| XLogP | -0.63 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|