C23H29N3O8 — CID 118082901
3-[(2R,3S,4aR)-5-acetyl-7-amino-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide (PubChem CID 118082901) has the molecular formula C23H29N3O8 and a molecular weight of 475.50 g/mol. Its IUPAC name is 3-[(2R,3S,4aR)-5-acetyl-7-amino-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide.
| Compound Name | 3-[(2R,3S,4aR)-5-acetyl-7-amino-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 118082901 |
| Molecular Formula | C23H29N3O8 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[(2R,3S,4aR)-5-acetyl-7-amino-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide |
| SMILES | CC(=O)c1cc(N)c(O)c2c1C[C@H]1C[C@@H]([C@@H](CO)N(C)C)[C@@](O)(C(=O)CC(N)=O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H29N3O8/c1-9(28)11-6-14(24)20(31)19-12(11)4-10-5-13(15(8-27)26(2)3)23(34,16(29)7-17(25)30)22(33)18(10)21(19)32/h6,10,13,15,27,31-32,34H,4-5,7-8,24H2,1-3H3,(H2,25,30)/t10-,13-,15+,23+/m0/s1 |
| InChIKey | CFZINRDZCJEROK-GCFITLQWSA-N |
| XLogP | -0.69 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|