C31H47N3O7 — CID 158200065
3-[(2R,3S,4aR)-5-(dimethylamino)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-(4-ethylhexyl)-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide (PubChem CID 158200065) has the molecular formula C31H47N3O7 and a molecular weight of 573.73 g/mol. Its IUPAC name is 3-[(2R,3S,4aR)-5-(dimethylamino)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-(4-ethylhexyl)-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide.
| Compound Name | 3-[(2R,3S,4aR)-5-(dimethylamino)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-(4-ethylhexyl)-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 158200065 |
| Molecular Formula | C31H47N3O7 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | 3-[(2R,3S,4aR)-5-(dimethylamino)-3-[1-(dimethylamino)-2-hydroxyethyl]-7-(4-ethylhexyl)-2,8,9-trihydroxy-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide |
| SMILES | CCC(CC)CCCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@](O)(C(=O)CC(N)=O)[C@H](C(CO)N(C)C)C[C@@H]1C2 |
| InChI | InChI=1S/C31H47N3O7/c1-7-17(8-2)10-9-11-18-14-22(33(3)4)20-12-19-13-21(23(16-35)34(5)6)31(41,24(36)15-25(32)37)30(40)26(19)29(39)27(20)28(18)38/h14,17,19,21,23,35,38-39,41H,7-13,15-16H2,1-6H3,(H2,32,37)/t19-,21-,23?,31+/m0/s1 |
| InChIKey | ZBSPOJUSBAXEQM-NHXLKVDVSA-N |
| XLogP | 2.35 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|