C24H31N3O8 — CID 123627523
3-[(2R,3S,4aR)-5-acetyl-7-(aminomethyl)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8-dihydroxy-1,9-dioxo-4,4a,9a,10-tetrahydro-3H-anthracen-2-yl]-3-oxopropanamide (PubChem CID 123627523) has the molecular formula C24H31N3O8 and a molecular weight of 489.53 g/mol. Its IUPAC name is 3-[(2R,3S,4aR)-5-acetyl-7-(aminomethyl)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8-dihydroxy-1,9-dioxo-4,4a,9a,10-tetrahydro-3H-anthracen-2-yl]-3-oxopropanamide.
| Compound Name | 3-[(2R,3S,4aR)-5-acetyl-7-(aminomethyl)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8-dihydroxy-1,9-dioxo-4,4a,9a,10-tetrahydro-3H-anthracen-2-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 123627523 |
| Molecular Formula | C24H31N3O8 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 3-[(2R,3S,4aR)-5-acetyl-7-(aminomethyl)-3-[(1S)-1-(dimethylamino)-2-hydroxyethyl]-2,8-dihydroxy-1,9-dioxo-4,4a,9a,10-tetrahydro-3H-anthracen-2-yl]-3-oxopropanamide |
| SMILES | CC(=O)c1cc(CN)c(O)c2c1C[C@H]1C[C@@H]([C@@H](CO)N(C)C)[C@@](O)(C(=O)CC(N)=O)C(=O)C1C2=O |
| InChI | InChI=1S/C24H31N3O8/c1-10(29)13-5-12(8-25)21(32)20-14(13)4-11-6-15(16(9-28)27(2)3)24(35,17(30)7-18(26)31)23(34)19(11)22(20)33/h5,11,15-16,19,28,32,35H,4,6-9,25H2,1-3H3,(H2,26,31)/t11-,15-,16+,19?,24+/m0/s1 |
| InChIKey | DOSIEKJHFKBGFM-KYBFXQHNSA-N |
| XLogP | -1.29 |
| TPSA | 201.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|