C27H35N3O7 — CID 126548097
(4S,4aS,5aS,12aR)-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a-methyl-4-(methylamino)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 126548097) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a-methyl-4-(methylamino)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a-methyl-4-(methylamino)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 126548097 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (4S,4aS,5aS,12aR)-9-[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a-methyl-4-(methylamino)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(CNCC(C)(C)C)c4O)C[C@H]3C[C@@]12C |
| InChI | InChI=1S/C27H35N3O7/c1-25(2,3)11-30-10-13-7-6-12-8-14-9-26(4)21(29-5)20(33)17(24(28)36)23(35)27(26,37)22(34)16(14)19(32)15(12)18(13)31/h6-7,14,21,29-32,35,37H,8-11H2,1-5H3,(H2,28,36)/t14-,21+,26-,27-/m0/s1 |
| InChIKey | LPJLEHLDTSFDCW-SWBZSZNZSA-N |
| XLogP | 1.15 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|