C22H24O7 — CID 159670304
(4aR,11aR,12aS)-4,4a,6,7-tetrahydroxy-3-(1-hydroxypropylidene)-10-methyl-1,4,11,11a,12,12a-hexahydrotetracene-2,5-dione (PubChem CID 159670304) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (4aR,11aR,12aS)-4,4a,6,7-tetrahydroxy-3-(1-hydroxypropylidene)-10-methyl-1,4,11,11a,12,12a-hexahydrotetracene-2,5-dione.
| Compound Name | (4aR,11aR,12aS)-4,4a,6,7-tetrahydroxy-3-(1-hydroxypropylidene)-10-methyl-1,4,11,11a,12,12a-hexahydrotetracene-2,5-dione |
|---|---|
| PubChem CID | 159670304 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (4aR,11aR,12aS)-4,4a,6,7-tetrahydroxy-3-(1-hydroxypropylidene)-10-methyl-1,4,11,11a,12,12a-hexahydrotetracene-2,5-dione |
| SMILES | CCC(O)=C1C(=O)C[C@@H]2C[C@@H]3Cc4c(C)ccc(O)c4C(O)=C3C(=O)[C@]2(O)C1O |
| InChI | InChI=1S/C22H24O7/c1-3-13(23)18-15(25)8-11-6-10-7-12-9(2)4-5-14(24)17(12)19(26)16(10)20(27)22(11,29)21(18)28/h4-5,10-11,21,23-24,26,28-29H,3,6-8H2,1-2H3/t10-,11+,21?,22+/m1/s1 |
| InChIKey | YOMDXQRVVLWJMM-UBQFIXNRSA-N |
| XLogP | 2.02 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|