C13H24O5Si — CID 11808352
tert-butyl (4R)-4-hydroxy-3-oxo-4-[(2S,3S)-3-trimethylsilyloxiran-2-yl]butanoate (PubChem CID 11808352) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is tert-butyl (4R)-4-hydroxy-3-oxo-4-[(2S,3S)-3-trimethylsilyloxiran-2-yl]butanoate.
| Compound Name | tert-butyl (4R)-4-hydroxy-3-oxo-4-[(2S,3S)-3-trimethylsilyloxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 11808352 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | tert-butyl (4R)-4-hydroxy-3-oxo-4-[(2S,3S)-3-trimethylsilyloxiran-2-yl]butanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)[C@H](O)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C13H24O5Si/c1-13(2,3)18-9(15)7-8(14)10(16)11-12(17-11)19(4,5)6/h10-12,16H,7H2,1-6H3/t10-,11-,12-/m0/s1 |
| InChIKey | IQZVLLAVFKFFHL-SRVKXCTJSA-N |
| XLogP | 1.29 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|