C19H13N3O4S2 — CID 118090421
N-(4-methoxyphenyl)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide (PubChem CID 118090421) has the molecular formula C19H13N3O4S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 118090421 |
| Molecular Formula | C19H13N3O4S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cncc3cc(/C=C4\SC(=S)NC4=O)oc23)cc1 |
| InChI | InChI=1S/C19H13N3O4S2/c1-25-12-4-2-11(3-5-12)21-17(23)14-9-20-8-10-6-13(26-16(10)14)7-15-18(24)22-19(27)28-15/h2-9H,1H3,(H,21,23)(H,22,24,27)/b15-7- |
| InChIKey | HACNYUUNBCPCRF-CHHVJCJISA-N |
| XLogP | 3.58 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|