C19H13N3O5S — CID 118089992
2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-(3-methoxyphenyl)furo[3,2-c]pyridine-7-carboxamide (PubChem CID 118089992) has the molecular formula C19H13N3O5S and a molecular weight of 395.40 g/mol. Its IUPAC name is 2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-(3-methoxyphenyl)furo[3,2-c]pyridine-7-carboxamide.
| Compound Name | 2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-(3-methoxyphenyl)furo[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 118089992 |
| Molecular Formula | C19H13N3O5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-(3-methoxyphenyl)furo[3,2-c]pyridine-7-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)c1 |
| InChI | InChI=1S/C19H13N3O5S/c1-26-12-4-2-3-11(6-12)21-17(23)14-9-20-8-10-5-13(27-16(10)14)7-15-18(24)22-19(25)28-15/h2-9H,1H3,(H,21,23)(H,22,24,25)/b15-7+ |
| InChIKey | RATNOCVCWPGWKW-VIZOYTHASA-N |
| XLogP | 3.41 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|