C10H15N3O4 — CID 118091002
5-[(Z)-hydroxyiminomethyl]-1,3-dimethyl-6-propoxypyrimidine-2,4-dione (PubChem CID 118091002) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-[(Z)-hydroxyiminomethyl]-1,3-dimethyl-6-propoxypyrimidine-2,4-dione.
| Compound Name | 5-[(Z)-hydroxyiminomethyl]-1,3-dimethyl-6-propoxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118091002 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-[(Z)-hydroxyiminomethyl]-1,3-dimethyl-6-propoxypyrimidine-2,4-dione |
| SMILES | CCCOc1c(/C=N\O)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C10H15N3O4/c1-4-5-17-9-7(6-11-16)8(14)12(2)10(15)13(9)3/h6,16H,4-5H2,1-3H3/b11-6- |
| InChIKey | BUSDQWAKRZQEFC-WDZFZDKYSA-N |
| XLogP | -0.32 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|