C18H21NO3S — CID 11809715
(1S,2S,3S,5S)-3-(benzenesulfonyl)-1,5-dimethyl-1-oxido-2-phenylpyrrolidin-1-ium (PubChem CID 11809715) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is (1S,2S,3S,5S)-3-(benzenesulfonyl)-1,5-dimethyl-1-oxido-2-phenylpyrrolidin-1-ium.
| Compound Name | (1S,2S,3S,5S)-3-(benzenesulfonyl)-1,5-dimethyl-1-oxido-2-phenylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 11809715 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (1S,2S,3S,5S)-3-(benzenesulfonyl)-1,5-dimethyl-1-oxido-2-phenylpyrrolidin-1-ium |
| SMILES | C[C@H]1C[C@H](S(=O)(=O)c2ccccc2)[C@H](c2ccccc2)[N@@+]1(C)[O-] |
| InChI | InChI=1S/C18H21NO3S/c1-14-13-17(23(21,22)16-11-7-4-8-12-16)18(19(14,2)20)15-9-5-3-6-10-15/h3-12,14,17-18H,13H2,1-2H3/t14-,17-,18-,19-/m0/s1 |
| InChIKey | XEJOVKBMFNJELR-QZHFEQFPSA-N |
| XLogP | 3.31 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|