C4H10N2O — CID 118102125
(3S,4R)-3-amino-4-methylazetidin-2-ol (PubChem CID 118102125) has the molecular formula C4H10N2O and a molecular weight of 102.14 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-methylazetidin-2-ol.
| Compound Name | (3S,4R)-3-amino-4-methylazetidin-2-ol |
|---|---|
| PubChem CID | 118102125 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | (3S,4R)-3-amino-4-methylazetidin-2-ol |
| SMILES | C[C@H]1NC(O)[C@H]1N |
| InChI | InChI=1S/C4H10N2O/c1-2-3(5)4(7)6-2/h2-4,6-7H,5H2,1H3/t2-,3+,4?/m1/s1 |
| InChIKey | QHTIZEZZNBCPLT-BCDHYOAOSA-N |
| XLogP | -1.38 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |