C8H19N5O — CID 129090595
2-amino-3,7,9-trimethyl-1,2,4,5,6,8-hexahydropurin-6-ol (PubChem CID 129090595) has the molecular formula C8H19N5O and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-amino-3,7,9-trimethyl-1,2,4,5,6,8-hexahydropurin-6-ol.
| Compound Name | 2-amino-3,7,9-trimethyl-1,2,4,5,6,8-hexahydropurin-6-ol |
|---|---|
| PubChem CID | 129090595 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 2-amino-3,7,9-trimethyl-1,2,4,5,6,8-hexahydropurin-6-ol |
| SMILES | CN1CN(C)C2C1C(O)NC(N)N2C |
| InChI | InChI=1S/C8H19N5O/c1-11-4-12(2)7-5(11)6(14)10-8(9)13(7)3/h5-8,10,14H,4,9H2,1-3H3 |
| InChIKey | VGSDEVVULZWDPN-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |