C34H46N2 — CID 118102540
2,2,6,6-tetramethyl-4-[4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalen-2-yl]phenyl]piperidine (PubChem CID 118102540) has the molecular formula C34H46N2 and a molecular weight of 482.76 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalen-2-yl]phenyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalen-2-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 118102540 |
| Molecular Formula | C34H46N2 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.37 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalen-2-yl]phenyl]piperidine |
| SMILES | CC1(C)CC(c2ccc(-c3ccc4cc(C5CC(C)(C)NC(C)(C)C5)ccc4c3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C34H46N2/c1-31(2)19-29(20-32(3,4)35-31)24-11-9-23(10-12-24)25-13-14-27-18-28(16-15-26(27)17-25)30-21-33(5,6)36-34(7,8)22-30/h9-18,29-30,35-36H,19-22H2,1-8H3 |
| InChIKey | NVOZWDLMTXDNQU-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |