C20H32N4O3 — CID 118105671
tert-butyl 4-[4-amino-3-[butanoyl(methyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 118105671) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-3-[butanoyl(methyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-3-[butanoyl(methyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118105671 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl 4-[4-amino-3-[butanoyl(methyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CCCC(=O)N(C)c1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1N |
| InChI | InChI=1S/C20H32N4O3/c1-6-7-18(25)22(5)17-14-15(8-9-16(17)21)23-10-12-24(13-11-23)19(26)27-20(2,3)4/h8-9,14H,6-7,10-13,21H2,1-5H3 |
| InChIKey | GMPALDQQWFDNOO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|