C6H5F9 — CID 118107957
1,1,1,3,3-pentafluoropropane;(Z)-1,3,3,3-tetrafluoroprop-1-ene (PubChem CID 118107957) has the molecular formula C6H5F9 and a molecular weight of 248.09 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoropropane;(Z)-1,3,3,3-tetrafluoroprop-1-ene.
| Compound Name | 1,1,1,3,3-pentafluoropropane;(Z)-1,3,3,3-tetrafluoroprop-1-ene |
|---|---|
| PubChem CID | 118107957 |
| Molecular Formula | C6H5F9 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1,1,1,3,3-pentafluoropropane;(Z)-1,3,3,3-tetrafluoroprop-1-ene |
| SMILES | F/C=C\C(F)(F)F.FC(F)CC(F)(F)F |
| InChI | InChI=1S/C3H3F5.C3H2F4/c4-2(5)1-3(6,7)8;4-2-1-3(5,6)7/h2H,1H2;1-2H/b;2-1- |
| InChIKey | NFFSAKDMSUXZHJ-BTJKTKAUSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |