C38H58O9 — CID 118110361
4-[3-[(3S,5S,7S)-3-hydroxy-5-methoxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-2-yl]phenyl]butanoic acid (PubChem CID 118110361) has the molecular formula C38H58O9 and a molecular weight of 658.87 g/mol. Its IUPAC name is 4-[3-[(3S,5S,7S)-3-hydroxy-5-methoxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-2-yl]phenyl]butanoic acid.
| Compound Name | 4-[3-[(3S,5S,7S)-3-hydroxy-5-methoxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-2-yl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 118110361 |
| Molecular Formula | C38H58O9 |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.41 |
| IUPAC Name | 4-[3-[(3S,5S,7S)-3-hydroxy-5-methoxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-2-yl]phenyl]butanoic acid |
| SMILES | CCC(C=C(C)[C@H](C[C@H](C[C@H](O)C(C)(C)c1cccc(CCCC(=O)O)c1)OC)OCc1ccc(OC)cc1)COCOCCOC |
| InChI | InChI=1S/C38H58O9/c1-8-29(25-46-27-45-20-19-42-5)21-28(2)35(47-26-31-15-17-33(43-6)18-16-31)23-34(44-7)24-36(39)38(3,4)32-13-9-11-30(22-32)12-10-14-37(40)41/h9,11,13,15-18,21-22,29,34-36,39H,8,10,12,14,19-20,23-27H2,1-7H3,(H,40,41)/t29?,34-,35+,36+/m1/s1 |
| InChIKey | NVVLVRMTBCCJNT-BNWUSBJWSA-N |
| XLogP | 6.73 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|