C33H47BrO7 — CID 118123345
(Z,3S,7S,10R)-2-(3-bromophenyl)-3-hydroxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-5-one (PubChem CID 118123345) has the molecular formula C33H47BrO7 and a molecular weight of 635.64 g/mol. Its IUPAC name is (Z,3S,7S,10R)-2-(3-bromophenyl)-3-hydroxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-5-one.
| Compound Name | (Z,3S,7S,10R)-2-(3-bromophenyl)-3-hydroxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-5-one |
|---|---|
| PubChem CID | 118123345 |
| Molecular Formula | C33H47BrO7 |
| Molecular Weight | 635.64 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | (Z,3S,7S,10R)-2-(3-bromophenyl)-3-hydroxy-10-(2-methoxyethoxymethoxymethyl)-7-[(4-methoxyphenyl)methoxy]-2,8-dimethyldodec-8-en-5-one |
| SMILES | CC[C@H](/C=C(/C)[C@H](CC(=O)C[C@H](O)C(C)(C)c1cccc(Br)c1)OCc1ccc(OC)cc1)COCOCCOC |
| InChI | InChI=1S/C33H47BrO7/c1-7-25(21-40-23-39-16-15-37-5)17-24(2)31(41-22-26-11-13-30(38-6)14-12-26)19-29(35)20-32(36)33(3,4)27-9-8-10-28(34)18-27/h8-14,17-18,25,31-32,36H,7,15-16,19-23H2,1-6H3/b24-17-/t25-,31+,32+/m1/s1 |
| InChIKey | DLLQOBQJQJIWLN-XBARJDBBSA-N |
| XLogP | 6.64 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|