C24H22F3N5O4 — CID 118111498
[4-(trifluoromethoxy)phenyl]methyl (1R,2S,6R,7S)-9-(2H-benzotriazole-5-carbonyl)-4,9-diazatricyclo[5.3.0.02,6]decane-4-carboxylate (PubChem CID 118111498) has the molecular formula C24H22F3N5O4 and a molecular weight of 501.47 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl (1R,2S,6R,7S)-9-(2H-benzotriazole-5-carbonyl)-4,9-diazatricyclo[5.3.0.02,6]decane-4-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl (1R,2S,6R,7S)-9-(2H-benzotriazole-5-carbonyl)-4,9-diazatricyclo[5.3.0.02,6]decane-4-carboxylate |
|---|---|
| PubChem CID | 118111498 |
| Molecular Formula | C24H22F3N5O4 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl (1R,2S,6R,7S)-9-(2H-benzotriazole-5-carbonyl)-4,9-diazatricyclo[5.3.0.02,6]decane-4-carboxylate |
| SMILES | O=C(OCc1ccc(OC(F)(F)F)cc1)N1C[C@@H]2[C@H](C1)[C@H]1CN(C(=O)c3ccc4n[nH]nc4c3)C[C@@H]21 |
| InChI | InChI=1S/C24H22F3N5O4/c25-24(26,27)36-15-4-1-13(2-5-15)12-35-23(34)32-10-18-16-8-31(9-17(16)19(18)11-32)22(33)14-3-6-20-21(7-14)29-30-28-20/h1-7,16-19H,8-12H2,(H,28,29,30)/t16-,17+,18+,19- |
| InChIKey | KQGJFNOAZQYCQN-SEXKYXSUSA-N |
| XLogP | 3.44 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |