C23H22N6O4 — CID 118111578
4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzoic acid (PubChem CID 118111578) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzoic acid.
| Compound Name | 4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 118111578 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1N1CCN(c2ncnc3c2[nH]c(=O)n3-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H22N6O4/c1-33-18-8-7-15(22(30)31)13-17(18)27-9-11-28(12-10-27)20-19-21(25-14-24-20)29(23(32)26-19)16-5-3-2-4-6-16/h2-8,13-14H,9-12H2,1H3,(H,26,32)(H,30,31) |
| InChIKey | ATXDJRWEISNZMO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |