C23H23N7O3 — CID 118111661
4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide (PubChem CID 118111661) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide.
| Compound Name | 4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 118111661 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide |
| SMILES | COc1ccc(C(N)=O)cc1N1CCN(c2ncnc3c2[nH]c(=O)n3-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23N7O3/c1-33-18-8-7-15(20(24)31)13-17(18)28-9-11-29(12-10-28)21-19-22(26-14-25-21)30(23(32)27-19)16-5-3-2-4-6-16/h2-8,13-14H,9-12H2,1H3,(H2,24,31)(H,27,32) |
| InChIKey | DUFGDGBEPQVUIB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |