C25H27N7O4 — CID 118111655
N-(2-hydroxyethyl)-4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide (PubChem CID 118111655) has the molecular formula C25H27N7O4 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 118111655 |
| Molecular Formula | C25H27N7O4 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-(2-hydroxyethyl)-4-methoxy-3-[4-(8-oxo-9-phenyl-7H-purin-6-yl)piperazin-1-yl]benzamide |
| SMILES | COc1ccc(C(=O)NCCO)cc1N1CCN(c2ncnc3c2[nH]c(=O)n3-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N7O4/c1-36-20-8-7-17(24(34)26-9-14-33)15-19(20)30-10-12-31(13-11-30)22-21-23(28-16-27-22)32(25(35)29-21)18-5-3-2-4-6-18/h2-8,15-16,33H,9-14H2,1H3,(H,26,34)(H,29,35) |
| InChIKey | HKQJUXMQZXRYSP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |