C23H34O5 — CID 11811220
methyl (5S)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-(3-oxoprop-1-en-2-yl)cyclopentyl]methyl]-2-propan-2-ylcyclopenta-1,3-diene-1-carboxylate (PubChem CID 11811220) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (5S)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-(3-oxoprop-1-en-2-yl)cyclopentyl]methyl]-2-propan-2-ylcyclopenta-1,3-diene-1-carboxylate.
| Compound Name | methyl (5S)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-(3-oxoprop-1-en-2-yl)cyclopentyl]methyl]-2-propan-2-ylcyclopenta-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 11811220 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (5S)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-(3-oxoprop-1-en-2-yl)cyclopentyl]methyl]-2-propan-2-ylcyclopenta-1,3-diene-1-carboxylate |
| SMILES | C=C(C=O)[C@@H]1CC[C@@H](C)[C@H]1C[C@]1(COCOC)C=CC(C(C)C)=C1C(=O)OC |
| InChI | InChI=1S/C23H34O5/c1-15(2)18-9-10-23(13-28-14-26-5,21(18)22(25)27-6)11-20-16(3)7-8-19(20)17(4)12-24/h9-10,12,15-16,19-20H,4,7-8,11,13-14H2,1-3,5-6H3/t16-,19+,20-,23+/m1/s1 |
| InChIKey | NFIJCTMSSKXXOJ-WOSKWAQLSA-N |
| XLogP | 4.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|