C17H19N3O2 — CID 118130154
7-(1,4-diazepan-1-yl)-2-(2H-pyran-3-yl)-1,3-benzoxazole (PubChem CID 118130154) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 7-(1,4-diazepan-1-yl)-2-(2H-pyran-3-yl)-1,3-benzoxazole.
| Compound Name | 7-(1,4-diazepan-1-yl)-2-(2H-pyran-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 118130154 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 7-(1,4-diazepan-1-yl)-2-(2H-pyran-3-yl)-1,3-benzoxazole |
| SMILES | C1=COCC(c2nc3cccc(N4CCCNCC4)c3o2)=C1 |
| InChI | InChI=1S/C17H19N3O2/c1-5-14-16(15(6-1)20-9-3-7-18-8-10-20)22-17(19-14)13-4-2-11-21-12-13/h1-2,4-6,11,18H,3,7-10,12H2 |
| InChIKey | NVQQVJFNMNQKQL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |