C44H43BrClO3P — CID 118135204
6-bromo-13-chloro-10,16-bis(2,4,6-triethylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,10,16,18,20,22-decaene 13-oxide (PubChem CID 118135204) has the molecular formula C44H43BrClO3P and a molecular weight of 766.16 g/mol. Its IUPAC name is 6-bromo-13-chloro-10,16-bis(2,4,6-triethylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,10,16,18,20,22-decaene 13-oxide.
| Compound Name | 6-bromo-13-chloro-10,16-bis(2,4,6-triethylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,10,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 118135204 |
| Molecular Formula | C44H43BrClO3P |
| Molecular Weight | 766.16 g/mol |
| Exact Mass | 764.18 |
| IUPAC Name | 6-bromo-13-chloro-10,16-bis(2,4,6-triethylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,10,16,18,20,22-decaene 13-oxide |
| SMILES | CCc1cc(CC)c(-c2cc3ccccc3c3c2OP(=O)(Cl)Oc2c(-c4c(CC)cc(CC)cc4CC)cc4cc(Br)ccc4c2-3)c(CC)c1 |
| InChI | InChI=1S/C44H43BrClO3P/c1-7-26-19-28(9-3)39(29(10-4)20-26)37-24-32-15-13-14-16-35(32)41-42-36-18-17-34(45)23-33(36)25-38(44(42)49-50(46,47)48-43(37)41)40-30(11-5)21-27(8-2)22-31(40)12-6/h13-25H,7-12H2,1-6H3 |
| InChIKey | KTZBNEPJTHYWNB-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.16 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|