C13H20NO5P — CID 118136180
[(2R,3S,5S)-3-[amino(methoxy)phosphoryl]oxy-5-benzyloxolan-2-yl]methanol (PubChem CID 118136180) has the molecular formula C13H20NO5P and a molecular weight of 301.28 g/mol. Its IUPAC name is [(2R,3S,5S)-3-[amino(methoxy)phosphoryl]oxy-5-benzyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5S)-3-[amino(methoxy)phosphoryl]oxy-5-benzyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 118136180 |
| Molecular Formula | C13H20NO5P |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [(2R,3S,5S)-3-[amino(methoxy)phosphoryl]oxy-5-benzyloxolan-2-yl]methanol |
| SMILES | COP(N)(=O)O[C@H]1C[C@H](Cc2ccccc2)O[C@@H]1CO |
| InChI | InChI=1S/C13H20NO5P/c1-17-20(14,16)19-12-8-11(18-13(12)9-15)7-10-5-3-2-4-6-10/h2-6,11-13,15H,7-9H2,1H3,(H2,14,16)/t11-,12-,13+,20?/m0/s1 |
| InChIKey | GRAZMTPIMWGSCD-DJDVAELESA-N |
| XLogP | 1.48 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|