About benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate
benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate (PubChem CID 102329507) has the molecular formula C14H18O6
and a molecular weight of 282.29 g/mol. Its IUPAC name is benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate.
Analyze benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate?
The IUPAC name of benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate (CID 102329507) is benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate.
What is the SMILES notation for benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate?
The canonical SMILES for benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate is CO[C@@H]1C[C@H](OC(=O)OCc2ccccc2)[C@@H](CO)O1.
What is the InChIKey of benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate?
The InChIKey is KJYYZPUNQJBVRX-XQQFMLRXSA-N. The full InChI is InChI=1S/C14H18O6/c1-17-13-7-11(12(8-15)19-13)20-14(16)18-9-10-5-3-2-4-6-10/h2-6,11-13,15H,7-9H2,1H3/t11-,12+,13-/m0/s1.
What are the key properties of benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate?
benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate has a molecular weight of 282.29 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] carbonate is sourced from PubChem (CID 102329507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).