C21H26ClN5O4S — CID 118137058
4-[[4-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]piperazin-1-yl]methyl]-3-hydroxy-1-(4-methylphenyl)sulfonylpyridin-2-one (PubChem CID 118137058) has the molecular formula C21H26ClN5O4S and a molecular weight of 479.99 g/mol. Its IUPAC name is 4-[[4-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]piperazin-1-yl]methyl]-3-hydroxy-1-(4-methylphenyl)sulfonylpyridin-2-one.
| Compound Name | 4-[[4-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]piperazin-1-yl]methyl]-3-hydroxy-1-(4-methylphenyl)sulfonylpyridin-2-one |
|---|---|
| PubChem CID | 118137058 |
| Molecular Formula | C21H26ClN5O4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-[[4-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]piperazin-1-yl]methyl]-3-hydroxy-1-(4-methylphenyl)sulfonylpyridin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(CN3CCN(/C(N)=C/C=C(\N)Cl)CC3)c(O)c2=O)cc1 |
| InChI | InChI=1S/C21H26ClN5O4S/c1-15-2-4-17(5-3-15)32(30,31)27-9-8-16(20(28)21(27)29)14-25-10-12-26(13-11-25)19(24)7-6-18(22)23/h2-9,28H,10-14,23-24H2,1H3/b18-6-,19-7+ |
| InChIKey | JDVVQJPPPBNCFM-BGOPHSEASA-N |
| XLogP | 1.06 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|