C21H21N5O3S — CID 118138581
2-amino-3-[4-[[N'-[[3-(1,3-thiazol-4-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138581) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-amino-3-[4-[[N'-[[3-(1,3-thiazol-4-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[N'-[[3-(1,3-thiazol-4-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138581 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-amino-3-[4-[[N'-[[3-(1,3-thiazol-4-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | N/C(=N\Cc1cccc(-c2cscn2)c1)NC(=O)c1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C21H21N5O3S/c22-17(20(28)29)9-13-4-6-15(7-5-13)19(27)26-21(23)24-10-14-2-1-3-16(8-14)18-11-30-12-25-18/h1-8,11-12,17H,9-10,22H2,(H,28,29)(H3,23,24,26,27) |
| InChIKey | XZDUQFCHITVVDM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|