C14H27N2O3+ — CID 118143845
3-carboxypropyl-dimethyl-[4-(2-methylprop-2-enoylamino)butyl]azanium (PubChem CID 118143845) has the molecular formula C14H27N2O3+ and a molecular weight of 271.38 g/mol. Its IUPAC name is 3-carboxypropyl-dimethyl-[4-(2-methylprop-2-enoylamino)butyl]azanium.
| Compound Name | 3-carboxypropyl-dimethyl-[4-(2-methylprop-2-enoylamino)butyl]azanium |
|---|---|
| PubChem CID | 118143845 |
| Molecular Formula | C14H27N2O3+ |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 3-carboxypropyl-dimethyl-[4-(2-methylprop-2-enoylamino)butyl]azanium |
| SMILES | C=C(C)C(=O)NCCCC[N+](C)(C)CCCC(=O)O |
| InChI | InChI=1S/C14H26N2O3/c1-12(2)14(19)15-9-5-6-10-16(3,4)11-7-8-13(17)18/h1,5-11H2,2-4H3,(H-,15,17,18,19)/p+1 |
| InChIKey | QGJBDLALJOXBDV-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|