C34H27F5N2O7 — CID 11814411
(2,3,4,5,6-pentafluorophenyl) 2-[[(E)-3-[4-phenylmethoxy-3-[2-(phenylmethoxycarbonylamino)ethoxy]phenyl]prop-2-enoyl]amino]acetate (PubChem CID 11814411) has the molecular formula C34H27F5N2O7 and a molecular weight of 670.59 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[[(E)-3-[4-phenylmethoxy-3-[2-(phenylmethoxycarbonylamino)ethoxy]phenyl]prop-2-enoyl]amino]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[[(E)-3-[4-phenylmethoxy-3-[2-(phenylmethoxycarbonylamino)ethoxy]phenyl]prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 11814411 |
| Molecular Formula | C34H27F5N2O7 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 670.17 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[[(E)-3-[4-phenylmethoxy-3-[2-(phenylmethoxycarbonylamino)ethoxy]phenyl]prop-2-enoyl]amino]acetate |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2)c(OCCNC(=O)OCc2ccccc2)c1)NCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H27F5N2O7/c35-28-29(36)31(38)33(32(39)30(28)37)48-27(43)18-41-26(42)14-12-21-11-13-24(46-19-22-7-3-1-4-8-22)25(17-21)45-16-15-40-34(44)47-20-23-9-5-2-6-10-23/h1-14,17H,15-16,18-20H2,(H,40,44)(H,41,42)/b14-12+ |
| InChIKey | AJRDEQHRFAUJIH-WYMLVPIESA-N |
| XLogP | 6.00 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|