C54H42N2O2P2 — CID 11814772
(15R,16R)-15-N,16-N-bis(2-diphenylphosphanylphenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide (PubChem CID 11814772) has the molecular formula C54H42N2O2P2 and a molecular weight of 812.89 g/mol. Its IUPAC name is (15R,16R)-15-N,16-N-bis(2-diphenylphosphanylphenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide.
| Compound Name | (15R,16R)-15-N,16-N-bis(2-diphenylphosphanylphenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide |
|---|---|
| PubChem CID | 11814772 |
| Molecular Formula | C54H42N2O2P2 |
| Molecular Weight | 812.89 g/mol |
| Exact Mass | 812.27 |
| IUPAC Name | (15R,16R)-15-N,16-N-bis(2-diphenylphosphanylphenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide |
| SMILES | O=C(Nc1ccccc1P(c1ccccc1)c1ccccc1)[C@@H]1C2c3ccccc3C(c3ccccc32)[C@H]1C(=O)Nc1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H42N2O2P2/c57-53(55-45-33-17-19-35-47(45)59(37-21-5-1-6-22-37)38-23-7-2-8-24-38)51-49-41-29-13-15-31-43(41)50(44-32-16-14-30-42(44)49)52(51)54(58)56-46-34-18-20-36-48(46)60(39-25-9-3-10-26-39)40-27-11-4-12-28-40/h1-36,49-52H,(H,55,57)(H,56,58)/t49?,50?,51-,52-/m1/s1 |
| InChIKey | JEZKFQJLLYZLOP-VSTSRGMYSA-N |
| XLogP | 9.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.89 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|