C18H15N3O — CID 118156338
3,8-dimethyl-4-pyridin-3-yl-1,5-dihydropyrido[3,2-b]indol-2-one (PubChem CID 118156338) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 3,8-dimethyl-4-pyridin-3-yl-1,5-dihydropyrido[3,2-b]indol-2-one.
| Compound Name | 3,8-dimethyl-4-pyridin-3-yl-1,5-dihydropyrido[3,2-b]indol-2-one |
|---|---|
| PubChem CID | 118156338 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3,8-dimethyl-4-pyridin-3-yl-1,5-dihydropyrido[3,2-b]indol-2-one |
| SMILES | Cc1ccc2[nH]c3c(-c4cccnc4)c(C)c(=O)[nH]c3c2c1 |
| InChI | InChI=1S/C18H15N3O/c1-10-5-6-14-13(8-10)16-17(20-14)15(11(2)18(22)21-16)12-4-3-7-19-9-12/h3-9,20H,1-2H3,(H,21,22) |
| InChIKey | USYRIMKLFYJFGR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |