C15H23O4P — CID 118160466
[(3R)-3,6-dimethyl-2-oxo-6-phenylheptyl]phosphonic acid (PubChem CID 118160466) has the molecular formula C15H23O4P and a molecular weight of 298.32 g/mol. Its IUPAC name is [(3R)-3,6-dimethyl-2-oxo-6-phenylheptyl]phosphonic acid.
| Compound Name | [(3R)-3,6-dimethyl-2-oxo-6-phenylheptyl]phosphonic acid |
|---|---|
| PubChem CID | 118160466 |
| Molecular Formula | C15H23O4P |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [(3R)-3,6-dimethyl-2-oxo-6-phenylheptyl]phosphonic acid |
| SMILES | C[C@H](CCC(C)(C)c1ccccc1)C(=O)CP(=O)(O)O |
| InChI | InChI=1S/C15H23O4P/c1-12(14(16)11-20(17,18)19)9-10-15(2,3)13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3,(H2,17,18,19)/t12-/m1/s1 |
| InChIKey | QGWJJALQKUQRHZ-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|