C18H11F4NO5 — CID 118176384
3-[(E)-3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzoxazol-2-one (PubChem CID 118176384) has the molecular formula C18H11F4NO5 and a molecular weight of 397.28 g/mol. Its IUPAC name is 3-[(E)-3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(E)-3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 118176384 |
| Molecular Formula | C18H11F4NO5 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 3-[(E)-3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzoxazol-2-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)c(OC(F)F)c1)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C18H11F4NO5/c19-16(20)26-13-7-5-10(9-14(13)27-17(21)22)6-8-15(24)23-11-3-1-2-4-12(11)28-18(23)25/h1-9,16-17H/b8-6+ |
| InChIKey | MWOWCYHHZXZFIR-SOFGYWHQSA-N |
| XLogP | 4.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|