C13H24N2O3 — CID 11817716
(3aR,4S,6aS)-2,2-dimethyl-N-pentyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11817716) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is (3aR,4S,6aS)-2,2-dimethyl-N-pentyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,4S,6aS)-2,2-dimethyl-N-pentyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11817716 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (3aR,4S,6aS)-2,2-dimethyl-N-pentyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@H]1NC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H24N2O3/c1-4-5-6-7-14-12(16)10-11-9(8-15-10)17-13(2,3)18-11/h9-11,15H,4-8H2,1-3H3,(H,14,16)/t9-,10-,11-/m0/s1 |
| InChIKey | WILUNBOHTYDBIF-DCAQKATOSA-N |
| XLogP | 0.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|