C13H23N3O3 — CID 153338126
[(3aR,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 153338126) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is [(3aR,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(3aR,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 153338126 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | [(3aR,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2C[C@H]3OC(C)(C)O[C@H]3N2)CC1 |
| InChI | InChI=1S/C13H23N3O3/c1-13(2)18-10-8-9(14-11(10)19-13)12(17)16-6-4-15(3)5-7-16/h9-11,14H,4-8H2,1-3H3/t9?,10-,11-/m1/s1 |
| InChIKey | VQHSZLYQRUOPMZ-FHZGLPGMSA-N |
| XLogP | -0.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |