C17H30N2O4 — CID 11709633
5-butanoyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11709633) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-butanoyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | 5-butanoyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11709633 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 5-butanoyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCCCNC(=O)C1C2OC(C)(C)OC2CN1C(=O)CCC |
| InChI | InChI=1S/C17H30N2O4/c1-5-7-8-10-18-16(21)14-15-12(22-17(3,4)23-15)11-19(14)13(20)9-6-2/h12,14-15H,5-11H2,1-4H3,(H,18,21) |
| InChIKey | FGMFKTLGDAFLLW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|