C17H32N2O3 — CID 11186051
(3aR,4S,6aS)-5-butyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11186051) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-butyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,4S,6aS)-5-butyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11186051 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | (3aR,4S,6aS)-5-butyl-2,2-dimethyl-N-pentyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2CN1CCCC |
| InChI | InChI=1S/C17H32N2O3/c1-5-7-9-10-18-16(20)14-15-13(21-17(3,4)22-15)12-19(14)11-8-6-2/h13-15H,5-12H2,1-4H3,(H,18,20)/t13-,14-,15-/m0/s1 |
| InChIKey | GVVMSMDIMPKGKK-KKUMJFAQSA-N |
| XLogP | 2.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|