C16H28N2O4 — CID 11392813
(3aR,4S,6aS)-5-butanoyl-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11392813) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-butanoyl-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,4S,6aS)-5-butanoyl-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11392813 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (3aR,4S,6aS)-5-butanoyl-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2CN1C(=O)CCC |
| InChI | InChI=1S/C16H28N2O4/c1-5-7-9-17-15(20)13-14-11(21-16(3,4)22-14)10-18(13)12(19)8-6-2/h11,13-14H,5-10H2,1-4H3,(H,17,20)/t11-,13-,14-/m0/s1 |
| InChIKey | SIUKZWLNCXZNLL-UBHSHLNASA-N |
| XLogP | 1.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|