C16H27N3O5 — CID 11175235
(3aR,4S,6aS)-5-(2-acetamidoacetyl)-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11175235) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-(2-acetamidoacetyl)-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,4S,6aS)-5-(2-acetamidoacetyl)-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11175235 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (3aR,4S,6aS)-5-(2-acetamidoacetyl)-N-butyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2CN1C(=O)CNC(C)=O |
| InChI | InChI=1S/C16H27N3O5/c1-5-6-7-17-15(22)13-14-11(23-16(3,4)24-14)9-19(13)12(21)8-18-10(2)20/h11,13-14H,5-9H2,1-4H3,(H,17,22)(H,18,20)/t11-,13-,14-/m0/s1 |
| InChIKey | CEOUQHDCRNVQJX-UBHSHLNASA-N |
| XLogP | -0.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|