C15H30O3Si — CID 11818517
(4R)-4-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]oxetan-2-one (PubChem CID 11818517) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is (4R)-4-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]oxetan-2-one.
| Compound Name | (4R)-4-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]oxetan-2-one |
|---|---|
| PubChem CID | 11818517 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (4R)-4-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]oxetan-2-one |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H]1CC(=O)O1 |
| InChI | InChI=1S/C15H30O3Si/c1-10(2)14(11(3)12-9-13(16)17-12)18-19(7,8)15(4,5)6/h10-12,14H,9H2,1-8H3/t11-,12+,14+/m0/s1 |
| InChIKey | QLRGUZVOWOKWJB-OUCADQQQSA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|