About [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate
[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate (PubChem CID 11819756) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate.
Analyze [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate?
The IUPAC name of [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate (CID 11819756) is [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate.
What is the SMILES notation for [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate?
The canonical SMILES for [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate is CC(=O)OC[C@H]1OC=CC(=O)[C@@H]1O.
What is the InChIKey of [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate?
The InChIKey is VCBQIZCHUFWFQD-SFYZADRCSA-N. The full InChI is InChI=1S/C8H10O5/c1-5(9)13-4-7-8(11)6(10)2-3-12-7/h2-3,7-8,11H,4H2,1H3/t7-,8+/m1/s1.
What are the key properties of [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate?
[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate has a molecular weight of 186.16 g/mol, XLogP of -0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-hydroxy-4-oxo-2,3-dihydropyran-2-yl]methyl acetate is sourced from PubChem (CID 11819756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).