C10H14O4 — CID 11820050
(1R,3R,4S,6R,8S)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one (PubChem CID 11820050) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1R,3R,4S,6R,8S)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one.
| Compound Name | (1R,3R,4S,6R,8S)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one |
|---|---|
| PubChem CID | 11820050 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1R,3R,4S,6R,8S)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one |
| SMILES | CO[C@H]1C[C@@]2(C)O[C@@]3(C)[C@@H]1O[C@H]3C2=O |
| InChI | InChI=1S/C10H14O4/c1-9-4-5(12-3)7-10(2,14-9)8(13-7)6(9)11/h5,7-8H,4H2,1-3H3/t5-,7+,8-,9+,10-/m0/s1 |
| InChIKey | UQFXSLCXSVUEFK-SSEFDENASA-N |
| XLogP | 0.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |