C13H20O3 — CID 10823023
(1S,3S,6S,8R)-1-butyl-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one (PubChem CID 10823023) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1S,3S,6S,8R)-1-butyl-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one.
| Compound Name | (1S,3S,6S,8R)-1-butyl-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one |
|---|---|
| PubChem CID | 10823023 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1S,3S,6S,8R)-1-butyl-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-one |
| SMILES | CCCC[C@]12O[C@H]3CC[C@](C)(O[C@]31C)C2=O |
| InChI | InChI=1S/C13H20O3/c1-4-5-7-13-10(14)11(2)8-6-9(15-13)12(13,3)16-11/h9H,4-8H2,1-3H3/t9-,11-,12+,13+/m0/s1 |
| InChIKey | ZUHPISUXQRVQOV-FTYKPCCVSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |