About (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate
(2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate (PubChem CID 118201244) has the molecular formula C23H12Br2N2O2
and a molecular weight of 508.17 g/mol. Its IUPAC name is (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate |
| PubChem CID | 118201244 |
| Molecular Formula | C23H12Br2N2O2 |
| Molecular Weight | 508.17 g/mol |
| Exact Mass | 505.93 |
| IUPAC Name | (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate |
| SMILES | O=C(Oc1c(Br)cc(Br)c2nc3ccccc3nc12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H12Br2N2O2/c24-16-12-17(25)22(21-20(16)26-18-7-3-4-8-19(18)27-21)29-23(28)15-10-9-13-5-1-2-6-14(13)11-15/h1-12H |
| InChIKey | UOOGJCAWSNUPEC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.17 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate?
The IUPAC name of (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate (CID 118201244) is (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate.
What is the SMILES notation for (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate?
The canonical SMILES for (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate is O=C(Oc1c(Br)cc(Br)c2nc3ccccc3nc12)c1ccc2ccccc2c1.
What is the InChIKey of (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate?
The InChIKey is UOOGJCAWSNUPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12Br2N2O2/c24-16-12-17(25)22(21-20(16)26-18-7-3-4-8-19(18)27-21)29-23(28)15-10-9-13-5-1-2-6-14(13)11-15/h1-12H.
What are the key properties of (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate?
(2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate has a molecular weight of 508.17 g/mol, XLogP of 6.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dibromophenazin-1-yl) naphthalene-2-carboxylate is sourced from PubChem (CID 118201244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).