C25H26NO3P — CID 118202170
butyl 2-(1-oxo-1,2-diphenyl-3H-2,1λ5-benzazaphosphol-3-yl)acetate (PubChem CID 118202170) has the molecular formula C25H26NO3P and a molecular weight of 419.46 g/mol. Its IUPAC name is butyl 2-(1-oxo-1,2-diphenyl-3H-2,1λ5-benzazaphosphol-3-yl)acetate.
| Compound Name | butyl 2-(1-oxo-1,2-diphenyl-3H-2,1λ5-benzazaphosphol-3-yl)acetate |
|---|---|
| PubChem CID | 118202170 |
| Molecular Formula | C25H26NO3P |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | butyl 2-(1-oxo-1,2-diphenyl-3H-2,1λ5-benzazaphosphol-3-yl)acetate |
| SMILES | CCCCOC(=O)CC1c2ccccc2P(=O)(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C25H26NO3P/c1-2-3-18-29-25(27)19-23-22-16-10-11-17-24(22)30(28,21-14-8-5-9-15-21)26(23)20-12-6-4-7-13-20/h4-17,23H,2-3,18-19H2,1H3 |
| InChIKey | IHGWYWUTLJOLTK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|