C17H19FN5O8P — CID 118202250
[3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-5-fluorophenyl] dihydrogen phosphate (PubChem CID 118202250) has the molecular formula C17H19FN5O8P and a molecular weight of 471.34 g/mol. Its IUPAC name is [3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-5-fluorophenyl] dihydrogen phosphate.
| Compound Name | [3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-5-fluorophenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118202250 |
| Molecular Formula | C17H19FN5O8P |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-5-fluorophenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cc(F)cc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C17H19FN5O8P/c18-9-1-8(2-10(3-9)31-32(27,28)29)4-19-15-12-16(21-6-20-15)23(7-22-12)17-14(26)13(25)11(5-24)30-17/h1-3,6-7,11,13-14,17,24-26H,4-5H2,(H,19,20,21)(H2,27,28,29)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | GHXMFZHDKIAWHR-LSCFUAHRSA-N |
| XLogP | -0.34 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|